Products 71297-93-3
CAS 71297-93-3 is the registry number for Phenacetin Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)-(4-chlorophenyl)imino-oxidoazanium (CAS 71297-93-3) is a chemical compound with the molecular formula C12H8Cl2N2O and a molecular weight of 267.11 g/mol. IUPAC name: (4-chlorophenyl)-(4-chlorophenyl)imino-oxidoazanium. InChIKey: NMAZIJPSESMWSA-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2N2O |
|---|---|
| Molecular weight | 267.11 g/mol |
| IUPAC name | (4-chlorophenyl)-(4-chlorophenyl)imino-oxidoazanium |
| InChIKey | NMAZIJPSESMWSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+](C2=CC=C(C=C2)Cl)[O-])Cl |
Computed by PubChem (NCBI)
Synonyms:
Dcaob, Azoxybenzene, 4,4'-dichloro-, p,p'-Dichloroazoxybenzene, Diazene, bis(4-chlorophenyl)-, 1-oxide, Bis(4-chlorphenyl)diazene 1-oxide, Bis(4-chlorophenyl)diazene 1-oxide, Diazene, bis(4-chlorphenyl)-, 1-oxide, 4-16-00-00035 (Beilstein Handbook Reference), p,p'Dichloroazoxybenzene, Azoxybenzene, 4,4'dichloro