CAS 32566-01-1 appears in our catalog under these names: 2-(1H-Indol-2-yl)aniline, 97%, 97%, 2-(2'-AMINOPHENYL)INDOLE, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-(1H-indol-2-yl)aniline (CAS 32566-01-1) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-(1H-indol-2-yl)aniline. InChIKey: IAKRGXQCKYFJCB-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-(1H-indol-2-yl)aniline |
| InChIKey | IAKRGXQCKYFJCB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)C3=CC=CC=C3N |
Computed by PubChem (NCBI)