Products 379254-75-8
CAS 379254-75-8 appears in our catalog under these names: 3-[(4-Methoxy-phenyl)-methyl-sulfamoyl]-benzoic acid, 95%, 3-((4-Methoxyphenyl)(methyl)sulfamoyl)benzoic acid, 95%, 3-((4-Methoxyphenyl)(methyl)sulfamoyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
3-[(4-methoxyphenyl)-methylsulfamoyl]benzoic acid (CAS 379254-75-8) is a chemical compound with the molecular formula C15H15NO5S and a molecular weight of 321.3 g/mol. IUPAC name: 3-[(4-methoxyphenyl)-methylsulfamoyl]benzoic acid. InChIKey: GKVMEUQZSGJOCI-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5S |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | 3-[(4-methoxyphenyl)-methylsulfamoyl]benzoic acid |
| InChIKey | GKVMEUQZSGJOCI-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)OC)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)