CAS 32588-36-6 appears in our catalog under these names: Indole-2-acetic acid, Indole-2-acetic acid 95%, Indole-2-acetic acid, 97%, 97%, 2-(1H-Indol-2-yl)acetic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 500mg, 1000mg, 2000mg, 100mg, 1g, 5g, 25g.
2-(1H-indol-2-yl)acetic acid (CAS 32588-36-6) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 2-(1H-indol-2-yl)acetic acid. InChIKey: QOPBEBWGSGFROG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-(1H-indol-2-yl)acetic acid |
| InChIKey | QOPBEBWGSGFROG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)CC(=O)O |
Computed by PubChem (NCBI)