CAS 326-90-9 appears in our catalog under these names: 4,4,4–Trifluoro–1–(2–furyl)–1,3–butanedione, 4,4,4-Trifluoro-1-(2-furyl)-1,3-butanedione, 98% , 2-Furoyltrifluoroacetone, 4,4,4-Trifluoro-1-(furan-2-yl)butane-1,3-dione 98%, 4,4,4-TRIFLUORO-1-(2-FURYL)-1,3- &. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g.
4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione (CAS 326-90-9) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione. InChIKey: OWLPCALGCHDBCN-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 4,4,4-trifluoro-1-(furan-2-yl)butane-1,3-dione |
| InChIKey | OWLPCALGCHDBCN-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(=O)CC(=O)C(F)(F)F |
Computed by PubChem (NCBI)