CAS 32606-02-3 is the registry number for 4-Hydroxy-1,3-dimethylquinolin-2(1H)-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-1,3-dimethylquinolin-2-one (CAS 32606-02-3) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: 4-hydroxy-1,3-dimethylquinolin-2-one. InChIKey: HIYWPQWKGLOWRH-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 4-hydroxy-1,3-dimethylquinolin-2-one |
| InChIKey | HIYWPQWKGLOWRH-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N(C1=O)C)O |
Computed by PubChem (NCBI)