CAS 32664-14-5 appears in our catalog under these names: 4,4-Dimethyl-2-(4-bromophenyl)-2-oxazoline, 2-(4-Bromophenyl)-4,4-dimethyl-4,5-dihydrooxazole 95%, 2-(4-Bromophenyl)-4,4-dimethyl-4,5-dihydrooxazole, 95%, 95%, 2-(4-BROMOPHENYL)-4,5-DIHYDRO-4,4-DIMETHYLOXAZOLE, 96%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 5mg, 250mg, 1g, 5g, 10g, 25g.
2-(4-bromophenyl)-4,4-dimethyl-5H-1,3-oxazole (CAS 32664-14-5) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 2-(4-bromophenyl)-4,4-dimethyl-5H-1,3-oxazole. InChIKey: GXWMQSSSRSHOBL-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4,4-dimethyl-5H-1,3-oxazole |
| InChIKey | GXWMQSSSRSHOBL-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)