Products 327024-84-0

CAS 327024-84-0 is the registry number for COX-1/2-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[3-ethoxycarbonyl-2-methyl-5-(4-phenylphenyl)pyrrol-1-yl]acetic acid (CAS 327024-84-0) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: 2-[3-ethoxycarbonyl-2-methyl-5-(4-phenylphenyl)pyrrol-1-yl]acetic acid. InChIKey: ABLKJPNBORNQOH-UHFFFAOYSA-N.

Identity
Molecular formulaC22H21NO4
Molecular weight363.4 g/mol
IUPAC name2-[3-ethoxycarbonyl-2-methyl-5-(4-phenylphenyl)pyrrol-1-yl]acetic acid
InChIKeyABLKJPNBORNQOH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(N(C(=C1)C2=CC=C(C=C2)C3=CC=CC=C3)CC(=O)O)C

Computed by PubChem (NCBI)

Synonyms: orb2566604