CAS 327024-84-0 is the registry number for COX-1/2-IN-6. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-ethoxycarbonyl-2-methyl-5-(4-phenylphenyl)pyrrol-1-yl]acetic acid (CAS 327024-84-0) is a chemical compound with the molecular formula C22H21NO4 and a molecular weight of 363.4 g/mol. IUPAC name: 2-[3-ethoxycarbonyl-2-methyl-5-(4-phenylphenyl)pyrrol-1-yl]acetic acid. InChIKey: ABLKJPNBORNQOH-UHFFFAOYSA-N.
| Molecular formula | C22H21NO4 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 2-[3-ethoxycarbonyl-2-methyl-5-(4-phenylphenyl)pyrrol-1-yl]acetic acid |
| InChIKey | ABLKJPNBORNQOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C1)C2=CC=C(C=C2)C3=CC=CC=C3)CC(=O)O)C |
Computed by PubChem (NCBI)