Products 32703-79-0
CAS 32703-79-0 appears in our catalog under these names: 5–(tert–Butyl)isobenzofuran–1,3–dione, 4-tert-Butylphthalic Anhydride, >98.0%(GC)(T), 5-(tert-Butyl)isobenzofuran-1,3-dione 95%, 5-(tert-Butyl)isobenzofuran-1,3-dione, 95%, 95%, 5-(tert-Butyl)isobenzofuran-1,3-dione, 96.02%. Offered by: GLPBio, TCI, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 250mg, 25 g, 1 g, 10 g, 500 mg.
5-tert-butyl-2-benzofuran-1,3-dione (CAS 32703-79-0) is a chemical compound with the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. IUPAC name: 5-tert-butyl-2-benzofuran-1,3-dione. InChIKey: YLJYVKLZVHWUCT-UHFFFAOYSA-N.
| Molecular formula | C12H12O3 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 5-tert-butyl-2-benzofuran-1,3-dione |
| InChIKey | YLJYVKLZVHWUCT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
4-tert-Butylphthalic anhydride, 5-(tert-Butyl)isobenzofuran-1,3-dione, 5-tert-butyl-2-benzofuran-1,3-dione, 5-tert-butyl-1,3-dihydro-2-benzofuran-1,3-dione, 1,3-Isobenzofurandione, 5-(1,1-dimethylethyl)-, 4-t-butylphthalic anhydride, 4-t-butyl phthalic anhydride, 4-t-butyl-phthalic anhydride, 4-tert-Butylphthalic anhydride, 95%, 4-tert-Butylphthalic anhydride; >97%