CAS 32704-61-3 is the registry number for Ethyl 2,4-dimethylimidazo(1,5-a)pyrimidine-8-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Ethyl 2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxylate (CAS 32704-61-3) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: ethyl 2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxylate. InChIKey: GNBCQZPQUQPWDG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | ethyl 2,4-dimethylimidazo[1,5-a]pyrimidine-8-carboxylate |
| InChIKey | GNBCQZPQUQPWDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2N=C(C=C(N2C=N1)C)C |
Computed by PubChem (NCBI)