CAS 32711-60-7 is the registry number for Methyl 3-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 3-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (CAS 32711-60-7) is a chemical compound with the molecular formula C10H12O3S and a molecular weight of 212.27 g/mol. IUPAC name: methyl 3-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate. InChIKey: YLNJOZZBVZBPRI-UHFFFAOYSA-N.
| Molecular formula | C10H12O3S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | methyl 3-hydroxy-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| InChIKey | YLNJOZZBVZBPRI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)CCCC2)O |
Computed by PubChem (NCBI)