CAS 3275-44-3 appears in our catalog under these names: Sulfalene Impurity 1, 5-(4-Chlorophenyl)-6-methylpyrimidine-2,4-diamine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 750mg.
5-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine (CAS 3275-44-3) is a chemical compound with the molecular formula C11H11ClN4 and a molecular weight of 234.68 g/mol. IUPAC name: 5-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine. InChIKey: SNBBQZGVKQEBQT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-6-methylpyrimidine-2,4-diamine |
| InChIKey | SNBBQZGVKQEBQT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)N)N)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)