CAS 36323-70-3 appears in our catalog under these names: 4-Chloro-n,n-dimethyl-6-phenyl-1,3,5-triazin-2-amine, 95%, 4-Chloro-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine, 95+%, 4–Chloro–N,N–dimethyl–6–phenyl–1,3,5–triazin–2–amine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-chloro-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine (CAS 36323-70-3) is a chemical compound with the molecular formula C11H11ClN4 and a molecular weight of 234.68 g/mol. IUPAC name: 4-chloro-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine. InChIKey: ZZWOGAHPXAPUSB-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 4-chloro-N,N-dimethyl-6-phenyl-1,3,5-triazin-2-amine |
| InChIKey | ZZWOGAHPXAPUSB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC(=NC(=N1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)