CAS 959604-71-8 is the registry number for N-(4-Chlorophenyl)-1-methyl-1H-imidazole-4-carboximidamide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide (CAS 959604-71-8) is a chemical compound with the molecular formula C11H11ClN4 and a molecular weight of 234.68 g/mol. IUPAC name: N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide. InChIKey: QVFHJZWYKZXHEV-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | N'-(4-chlorophenyl)-1-methylimidazole-4-carboximidamide |
| InChIKey | QVFHJZWYKZXHEV-UHFFFAOYSA-N |
| SMILES | CN1C=C(N=C1)C(=NC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)