CAS 91066-67-0 appears in our catalog under these names: N4-Benzyl-6-chloropyrimidine-2,4-diamine, 95%, N~4~-benzyl-6-chloropyrimidine-2,4-diamine. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
4-N-benzyl-6-chloropyrimidine-2,4-diamine (CAS 91066-67-0) is a chemical compound with the molecular formula C11H11ClN4 and a molecular weight of 234.68 g/mol. IUPAC name: 4-N-benzyl-6-chloropyrimidine-2,4-diamine. InChIKey: GXNJAZPAQIPYMJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4 |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 4-N-benzyl-6-chloropyrimidine-2,4-diamine |
| InChIKey | GXNJAZPAQIPYMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC(=NC(=N2)N)Cl |
Computed by PubChem (NCBI)