Products 32857-62-8
CAS 32857-62-8 appears in our catalog under these names: 4–(Trifluoromethyl)phenylacetic acid, 4-(Trifluoromethyl)phenylacetic acid, 4-(Trifluoromethyl)phenylacetic Acid, >98.0%(T)(GC), (alpha,alpha,alpha-Trifluoro-p-tolyl)acetic acid, 98%, 4-(Trifluoromethyl)phenylacetic acid 98%. Offered by: GLPBio, Biosynth, TCI, Thermo Scientific (Acros), Ambeed. Available pack sizes: 100g, 25g, 0,5g, 1g, 5g, 1000g, 10g, 500g.
2-[4-(trifluoromethyl)phenyl]acetic acid (CAS 32857-62-8) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]acetic acid. InChIKey: HNORVZDAANCHAY-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | HNORVZDAANCHAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Benzeneacetic acid, 4-(trifluoromethyl)-, (alpha,alpha,alpha-Trifluoro-4-tolyl)acetic acid, 4-(Trifluoromethyl)phenylacetic acid, 2-(4-(trifluoromethyl)phenyl)acetic acid, 2-[4-(trifluoromethyl)phenyl]acetic acid, [4-(trifluoromethyl)phenyl]acetic acid, 4-Trifluoromethylphenylacetic acid, (alpha,alpha,alpha-Trifluoro-p-tolyl)acetic acid, p-(TRIFLUOROMETHYL)PHENYLACETIC ACID, p-Trifluoromethylphenylacetic acid