CAS 32863-21-1 appears in our catalog under these names: 2,1,3-Benzoxadiazole-4-carboxylic Acid, Benzo[c][1,2,5]oxadiazole-4-carboxylic acid, 98%, 98%, Benzo[c][1,2,5]oxadiazole-4-carboxylic acid, 98%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 0,5g, 50mg, 25mg, 250mg, 1g, 500mg, 5g.
2,1,3-benzoxadiazole-4-carboxylic acid (CAS 32863-21-1) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 2,1,3-benzoxadiazole-4-carboxylic acid. InChIKey: NGPYWZBQSYAKKK-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 2,1,3-benzoxadiazole-4-carboxylic acid |
| InChIKey | NGPYWZBQSYAKKK-UHFFFAOYSA-N |
| SMILES | C1=CC2=NON=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)