CAS 328918-82-7 appears in our catalog under these names: 2-(2-(4-Bromophenyl)-5-methyloxazol-4-yl)acetic acid, 95+%, 2-(2-(4-Bromophenyl)-5-methyloxazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[2-(4-bromophenyl)-5-methyl-1,3-oxazol-4-yl]acetic acid (CAS 328918-82-7) is a chemical compound with the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. IUPAC name: 2-[2-(4-bromophenyl)-5-methyl-1,3-oxazol-4-yl]acetic acid. InChIKey: FCVXIPPJDZQRCK-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO3 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 2-[2-(4-bromophenyl)-5-methyl-1,3-oxazol-4-yl]acetic acid |
| InChIKey | FCVXIPPJDZQRCK-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=C(C=C2)Br)CC(=O)O |
Computed by PubChem (NCBI)