CAS 328955-86-8 is the registry number for 6-Amino-4,4-dimethyl-1H-benzo[d][1,3]oxazin-2(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-4,4-dimethyl-1H-3,1-benzoxazin-2-one (CAS 328955-86-8) is a chemical compound with the molecular formula C10H12N2O2 and a molecular weight of 192.21 g/mol. IUPAC name: 6-amino-4,4-dimethyl-1H-3,1-benzoxazin-2-one. InChIKey: CWCFTPKEXHPIFD-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O2 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 6-amino-4,4-dimethyl-1H-3,1-benzoxazin-2-one |
| InChIKey | CWCFTPKEXHPIFD-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)N)NC(=O)O1)C |
Computed by PubChem (NCBI)