CAS 329268-85-1 is the registry number for 2-(Butyl(methyl)amino)-5-chloropyrimidine-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxylic acid (CAS 329268-85-1) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: 2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxylic acid. InChIKey: YZNBLNJBPVVSBL-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | 2-[butyl(methyl)amino]-5-chloropyrimidine-4-carboxylic acid |
| InChIKey | YZNBLNJBPVVSBL-UHFFFAOYSA-N |
| SMILES | CCCCN(C)C1=NC=C(C(=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)