Products 329783-03-1
CAS 329783-03-1 is the registry number for α-Amylase/α-Glucosidase-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(1H-indol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine (CAS 329783-03-1) is a chemical compound with the molecular formula C11H9N5 and a molecular weight of 211.22 g/mol. IUPAC name: (E)-1-(1H-indol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine. InChIKey: JGAIKVXQWSGKCO-MKMNVTDBSA-N.
| Molecular formula | C11H9N5 |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | (E)-1-(1H-indol-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| InChIKey | JGAIKVXQWSGKCO-MKMNVTDBSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N2)/C=N/N3C=NN=C3 |
Computed by PubChem (NCBI)