CAS 33014-68-5 appears in our catalog under these names: Boc-phe-leu-oh, 95%, BOC–PHE–LEU–OH, Boc-Phe-Leu-OH, 95%, 95%, Boc-Phe-Leu-OH. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 5g, 100mg, 250 mg, 100 mg, 1 g, 50 mg.
(2S)-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid (CAS 33014-68-5) is a chemical compound with the molecular formula C20H30N2O5 and a molecular weight of 378.5 g/mol. IUPAC name: (2S)-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid. InChIKey: WTUOGGZPHJOAND-HOTGVXAUSA-N.
| Molecular formula | C20H30N2O5 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2S)-4-methyl-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]pentanoic acid |
| InChIKey | WTUOGGZPHJOAND-HOTGVXAUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)