CAS 42538-01-2 appears in our catalog under these names: (2S,3S)-2-((2S,3S)-2-(((Benzyloxy)carbonyl)amino)-3-methylpentanamido)-3-methylpentanoic acid, 95%, Z-Ile-ile-oh, 95%, Z-Ile-Ile, >95% (HPLC), Z–Ile–Ile, Cbz-Ile-Ile-OH 95%. Offered by: Fluorochem, Combi-blocks, TRC, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 500mg, 100mg, 100g.
(2S,3S)-3-methyl-2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid (CAS 42538-01-2) is a chemical compound with the molecular formula C20H30N2O5 and a molecular weight of 378.5 g/mol. IUPAC name: (2S,3S)-3-methyl-2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid. InChIKey: QJJULDSUCQXEDB-OTRWWLKZSA-N.
| Molecular formula | C20H30N2O5 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-[[(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid |
| InChIKey | QJJULDSUCQXEDB-OTRWWLKZSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)