CAS 7801-71-0 appears in our catalog under these names: Z-Leu-leu-oh, 95%, Z-Leu-Leu-OH, 98+%, Z–Leu–Leu–OH, Z-Leu-Leu-OH, ≥95%, ≥95%, (S)-2-((S)-2-(((Benzyloxy)carbonyl)amino)-4-methylpentanamido)-4-methylpentanoic acid, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g.
(2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid (CAS 7801-71-0) is a chemical compound with the molecular formula C20H30N2O5 and a molecular weight of 378.5 g/mol. IUPAC name: (2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid. InChIKey: XGJGWYRHLPSMLW-IRXDYDNUSA-N.
| Molecular formula | C20H30N2O5 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2S)-4-methyl-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]pentanoic acid |
| InChIKey | XGJGWYRHLPSMLW-IRXDYDNUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)