CAS 77946-33-9 is the registry number for Boc-Val-Ala-OBn, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Benzyl (2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoate (CAS 77946-33-9) is a chemical compound with the molecular formula C20H30N2O5 and a molecular weight of 378.5 g/mol. IUPAC name: benzyl (2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoate. InChIKey: FQWBPPZWWQDSGU-HOCLYGCPSA-N.
| Molecular formula | C20H30N2O5 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | benzyl (2S)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]propanoate |
| InChIKey | FQWBPPZWWQDSGU-HOCLYGCPSA-N |
| SMILES | C[C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)[C@H](C(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)