Products 33019-85-1
CAS 33019-85-1 appears in our catalog under these names: N-Pivaloyl-L-tyrosine, N-Pivaloyl-L-tyrosine, >95% (HPLC), N–Pivaloyl–L–tyrosine. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 250mg, 25mg, 10mg, 5mg, 100mg, 50mg, 25 mg.
(2S)-2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 33019-85-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: SUQCHHVYBPOPTR-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-(2,2-dimethylpropanoylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | SUQCHHVYBPOPTR-NSHDSACASA-N |
| SMILES | CC(C)(C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)