CAS 330216-79-0 is the registry number for 4-(tert-butyl)phenyl 4-phenylpiperazinyl ketone. Offered by: Biosynth. Available pack sizes: 250mg.
(4-tert-butylphenyl)-(4-phenylpiperazin-1-yl)methanone (CAS 330216-79-0) is a chemical compound with the molecular formula C21H26N2O and a molecular weight of 322.4 g/mol. IUPAC name: (4-tert-butylphenyl)-(4-phenylpiperazin-1-yl)methanone. InChIKey: RZXGWGGNXRADRN-UHFFFAOYSA-N.
| Molecular formula | C21H26N2O |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | (4-tert-butylphenyl)-(4-phenylpiperazin-1-yl)methanone |
| InChIKey | RZXGWGGNXRADRN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)N2CCN(CC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)