Products 33036-40-7

CAS 33036-40-7 is the registry number for tert-butyl (1-phenylethyl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.

Structural formula: {0} (CAS {1})

Tert-butyl N-(1-phenylethyl)carbamate (CAS 33036-40-7) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: tert-butyl N-(1-phenylethyl)carbamate. InChIKey: WOIRCKJMSPMDAM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO2
Molecular weight221.29 g/mol
IUPAC nametert-butyl N-(1-phenylethyl)carbamate
InChIKeyWOIRCKJMSPMDAM-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)NC(=O)OC(C)(C)C

Computed by PubChem (NCBI)