CAS 33099-08-0 appears in our catalog under these names: Z–N–Me–Leu–OH, Z-N-Me-Leu-OH 98%, N-Methyl-N-[(phenylmethoxy)carbonyl]-L-leucine, 98%, 98%, (S)-2-(((Benzyloxy)carbonyl)(methyl)amino)-4-methylpentanoic acid, 98.34%, Cbz-N-methyl-L-leucine, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g, 25 g, 5 g, 10 g.
(2S)-4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid (CAS 33099-08-0) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid. InChIKey: TVXSGOBGRXNJLM-ZDUSSCGKSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid |
| InChIKey | TVXSGOBGRXNJLM-ZDUSSCGKSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)