Products 33105-11-2
CAS 33105-11-2 appears in our catalog under these names: (E)–Methyl 3–bromo–2–methyl–3–phenylacrylate, (E)-Methyl 3-bromo-2-methyl-3-phenylacrylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 50mg, 250mg, 100mg, 1g.
Methyl (E)-3-bromo-2-methyl-3-phenylprop-2-enoate (CAS 33105-11-2) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: methyl (E)-3-bromo-2-methyl-3-phenylprop-2-enoate. InChIKey: FIOYGBYNTPFQMG-CSKARUKUSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | methyl (E)-3-bromo-2-methyl-3-phenylprop-2-enoate |
| InChIKey | FIOYGBYNTPFQMG-CSKARUKUSA-N |
| SMILES | C/C(=C(/C1=CC=CC=C1)\Br)/C(=O)OC |
Computed by PubChem (NCBI)