CAS 33119-65-2 appears in our catalog under these names: 4-Phenyloxazol-2-amine, 95%, 4-Phenyloxazol-2-amine 97%, 4-Phenyloxazol-2-amine, 97%, 4-Phenyloxazol-2-amine, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-phenyl-1,3-oxazol-2-amine (CAS 33119-65-2) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 4-phenyl-1,3-oxazol-2-amine. InChIKey: FXRWCCOADRNYMB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 4-phenyl-1,3-oxazol-2-amine |
| InChIKey | FXRWCCOADRNYMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=COC(=N2)N |
Computed by PubChem (NCBI)