CAS 331442-95-6 appears in our catalog under these names: 8-Aminoquinolin-7-ol, 97%, 8-Aminoquinolin-7-ol, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg, 2.5g.
8-aminoquinolin-7-ol (CAS 331442-95-6) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 8-aminoquinolin-7-ol. InChIKey: XSDGGSJNCLLCNW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 8-aminoquinolin-7-ol |
| InChIKey | XSDGGSJNCLLCNW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)O)N)N=C1 |
Computed by PubChem (NCBI)