CAS 3321-92-4 appears in our catalog under these names: 3',5'-Dichloro-2'-hydroxyacetophenone, 95%, 3',5'-Dichloro-2'-hydroxyacetophenone, 97%, 3',5'–Dichloro–2'–hydroxyacetophenone, 3',5'-Dichloro-2'-hydroxyacetophenone, 99% , 3',5'-Dichloro-2'-hydroxyacetophenone. Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 500g, 100g, 5g, 25g, 1g, 250g, 250mg, 10g.
1-(3,5-dichloro-2-hydroxyphenyl)ethanone (CAS 3321-92-4) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 1-(3,5-dichloro-2-hydroxyphenyl)ethanone. InChIKey: CJFYGRLJDKWMDI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
| InChIKey | CJFYGRLJDKWMDI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)