CAS 332119-10-5 is the registry number for 5-(2-Nitrophenyl)-N-(pyridin-3-yl)furan-2-carboxamide, 97%. Offered by: AmBeed. Available pack sizes: 100mg.
5-(2-nitrophenyl)-N-pyridin-3-ylfuran-2-carboxamide (CAS 332119-10-5) is a chemical compound with the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. IUPAC name: 5-(2-nitrophenyl)-N-pyridin-3-ylfuran-2-carboxamide. InChIKey: SMYJGEILXVHRBD-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O4 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 5-(2-nitrophenyl)-N-pyridin-3-ylfuran-2-carboxamide |
| InChIKey | SMYJGEILXVHRBD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C(=O)NC3=CN=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)