CAS 376358-93-9 appears in our catalog under these names: 3-(3-Nitrophenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 95%, 3-(3-Nitrophenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(3-nitrophenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 376358-93-9) is a chemical compound with the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. IUPAC name: 3-(3-nitrophenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: KGMUWYYQNULYQO-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O4 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 3-(3-nitrophenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | KGMUWYYQNULYQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)