CAS 65697-90-7 is the registry number for 4,4'–(1H–1,2,4–Triazole–3,5–diyl)dibenzoic acid. Offered by: GLPBio. Available pack sizes: 1g.
4-[3-(4-carboxyphenyl)-1H-1,2,4-triazol-5-yl]benzoic acid (CAS 65697-90-7) is a chemical compound with the molecular formula C16H11N3O4 and a molecular weight of 309.28 g/mol. IUPAC name: 4-[3-(4-carboxyphenyl)-1H-1,2,4-triazol-5-yl]benzoic acid. InChIKey: SXSLRMSHMPMPHK-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O4 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 4-[3-(4-carboxyphenyl)-1H-1,2,4-triazol-5-yl]benzoic acid |
| InChIKey | SXSLRMSHMPMPHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=NN2)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)