CAS 3323-73-7 appears in our catalog under these names: Benidipine Impurity 26, 1-Benzyl-3-Hydroxypyridin-1-Ium Chloride, 97%+, 97%+, 1-Benzylpyridin-1-ium-3-olate hydrochloride, 97%+(HPLC),RG. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g.
1-benzylpyridin-1-ium-3-ol chloride (CAS 3323-73-7) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: 1-benzylpyridin-1-ium-3-ol chloride. InChIKey: ONNZKJRJNUPXSG-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | 1-benzylpyridin-1-ium-3-ol chloride |
| InChIKey | ONNZKJRJNUPXSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C[N+]2=CC=CC(=C2)O.[Cl-] |
Computed by PubChem (NCBI)