CAS 33235-33-5 appears in our catalog under these names: 2-Amino-4-methoxy-1-methylbenzimidazole, 95+%, 4-Methoxy-1-methyl-1H-1,3-benzodiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
4-methoxy-1-methylbenzimidazol-2-amine (CAS 33235-33-5) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 4-methoxy-1-methylbenzimidazol-2-amine. InChIKey: RNJUSLPNRVXPPT-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4-methoxy-1-methylbenzimidazol-2-amine |
| InChIKey | RNJUSLPNRVXPPT-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=CC=C2)OC)N=C1N |
Computed by PubChem (NCBI)