CAS 3328-71-0 appears in our catalog under these names: 2,4–DIHYDROXY–BENZENE–1,3–DICARB–ALDEHYDE, 2,4-Dihydroxyisophthalaldehyde 95%, 2,4-Dihydroxyisophthalaldehyde, 95%, 95%, 2,4-Dihydroxyisophthalaldehyde, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2,4-dihydroxybenzene-1,3-dicarbaldehyde (CAS 3328-71-0) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 2,4-dihydroxybenzene-1,3-dicarbaldehyde. InChIKey: AYZFTYFURGCPEJ-UHFFFAOYSA-N.
| Molecular formula | C8H6O4 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | 2,4-dihydroxybenzene-1,3-dicarbaldehyde |
| InChIKey | AYZFTYFURGCPEJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C=O)O)C=O)O |
Computed by PubChem (NCBI)