Products 33280-14-7
CAS 33280-14-7 appears in our catalog under these names: 5-chloro-2-(methylamino)benzoic acid, 98%, 5–CHLORO–2–(METHYLAMINO)BENZOIC ACID, 5-Chloro-2-(methylamino)benzoic acid, 5-CHLORO-2-(METHYLAMINO)BENZOIC ACID, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 200mg, 0,5g, 50mg, 100mg, 10g.
5-chloro-2-(methylamino)benzoic acid (CAS 33280-14-7) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 5-chloro-2-(methylamino)benzoic acid. InChIKey: YZFWLQHILRFUTJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 5-chloro-2-(methylamino)benzoic acid |
| InChIKey | YZFWLQHILRFUTJ-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)