CAS 33300-72-0 appears in our catalog under these names: Boc–Ala–Pro–OH, (S)-1-((S)-2-((tert-Butoxycarbonyl)amino)propanoyl)pyrrolidine-2-carboxylic acid, 97%, 97%, Boc-Ala-Pro-OH, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g.
(2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylic acid (CAS 33300-72-0) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: QGJDXUIYIUGQGO-IUCAKERBSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | QGJDXUIYIUGQGO-IUCAKERBSA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)