CAS 64642-65-5 is the registry number for ((S)-2-Amino-4-(tert-butoxy)-4-oxobutanoyl)-L-proline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid (CAS 64642-65-5) is a chemical compound with the molecular formula C13H22N2O5 and a molecular weight of 286.32 g/mol. IUPAC name: (2S)-1-[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid. InChIKey: ZSUIRCJCXXBWHP-IUCAKERBSA-N.
| Molecular formula | C13H22N2O5 |
|---|---|
| Molecular weight | 286.32 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-amino-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | ZSUIRCJCXXBWHP-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)N |
Computed by PubChem (NCBI)