Products 333408-42-7
CAS 333408-42-7 is the registry number for (2-Chloro-6,8-dimethylquinolin-3-yl)methanol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2-chloro-6,8-dimethylquinolin-3-yl)methanol (CAS 333408-42-7) is a chemical compound with the molecular formula C12H12ClNO and a molecular weight of 221.68 g/mol. IUPAC name: (2-chloro-6,8-dimethylquinolin-3-yl)methanol. InChIKey: XXNOYBFTZFIWKN-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO |
|---|---|
| Molecular weight | 221.68 g/mol |
| IUPAC name | (2-chloro-6,8-dimethylquinolin-3-yl)methanol |
| InChIKey | XXNOYBFTZFIWKN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=C(C(=N2)Cl)CO)C |
Computed by PubChem (NCBI)