Products 33351-11-0
CAS 33351-11-0 is the registry number for Methyl (1,1':4',1''-terphenyl)-2'-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
Methyl 2,5-diphenylbenzoate (CAS 33351-11-0) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: methyl 2,5-diphenylbenzoate. InChIKey: QOJXMDPOLIYSTR-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | methyl 2,5-diphenylbenzoate |
| InChIKey | QOJXMDPOLIYSTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)