Products 444148-97-4

CAS 444148-97-4 is the registry number for 2-Methylphenyl (1,1′-biphenyl)-4-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

(2-methylphenyl) 4-phenylbenzoate (CAS 444148-97-4) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: (2-methylphenyl) 4-phenylbenzoate. InChIKey: YBVRBRRAJRAIAM-UHFFFAOYSA-N.

Identity
Molecular formulaC20H16O2
Molecular weight288.3 g/mol
IUPAC name(2-methylphenyl) 4-phenylbenzoate
InChIKeyYBVRBRRAJRAIAM-UHFFFAOYSA-N
SMILESCC1=CC=CC=C1OC(=O)C2=CC=C(C=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)