CAS 345294-27-1 is the registry number for 4,5-Diethenyl-4,5-dihydro-4,5-pyrenediol. Offered by: TRC. Available pack sizes: 500mg.
4,5-bis(ethenyl)pyrene-4,5-diol (CAS 345294-27-1) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 4,5-bis(ethenyl)pyrene-4,5-diol. InChIKey: ZYFXKLHFIUIDOQ-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 4,5-bis(ethenyl)pyrene-4,5-diol |
| InChIKey | ZYFXKLHFIUIDOQ-UHFFFAOYSA-N |
| SMILES | C=CC1(C2=CC=CC3=C2C4=C(C=CC=C4C1(C=C)O)C=C3)O |
Computed by PubChem (NCBI)