CAS 5543-98-6 is the registry number for Clomifene Impurity 15. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-(4-hydroxyphenyl)-1,2-diphenylethanone (CAS 5543-98-6) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1,2-diphenylethanone. InChIKey: NYNQPHLKQQWYQE-UHFFFAOYSA-N.
| Molecular formula | C20H16O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-1,2-diphenylethanone |
| InChIKey | NYNQPHLKQQWYQE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)O)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)