Products 5543-98-6

CAS 5543-98-6 is the registry number for Clomifene Impurity 15. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-(4-hydroxyphenyl)-1,2-diphenylethanone (CAS 5543-98-6) is a chemical compound with the molecular formula C20H16O2 and a molecular weight of 288.3 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-1,2-diphenylethanone. InChIKey: NYNQPHLKQQWYQE-UHFFFAOYSA-N.

Identity
Molecular formulaC20H16O2
Molecular weight288.3 g/mol
IUPAC name2-(4-hydroxyphenyl)-1,2-diphenylethanone
InChIKeyNYNQPHLKQQWYQE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=C(C=C2)O)C(=O)C3=CC=CC=C3

Computed by PubChem (NCBI)