CAS 33439-27-9 appears in our catalog under these names: 1-Tosylpiperidin-4-one, 95-<97%, 1-Tosylpiperidin-4-one, ≥97-<99%, 1–Tosylpiperidin–4–one. Offered by: Hoffman Fine Chemicals, GLPBio. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 1g, 5g.
1-(4-methylphenyl)sulfonylpiperidin-4-one (CAS 33439-27-9) is a chemical compound with the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpiperidin-4-one. InChIKey: PCEBUFJFSAZGNQ-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3S |
|---|---|
| Molecular weight | 253.32 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpiperidin-4-one |
| InChIKey | PCEBUFJFSAZGNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC(=O)CC2 |
Computed by PubChem (NCBI)