CAS 334504-68-6 is the registry number for 6-Chloro-1,2,3,4,9,10-hexahydroacridin-9-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-2,3,4,10-tetrahydro-1H-acridin-9-one (CAS 334504-68-6) is a chemical compound with the molecular formula C13H12ClNO and a molecular weight of 233.69 g/mol. IUPAC name: 6-chloro-2,3,4,10-tetrahydro-1H-acridin-9-one. InChIKey: HIIMAULBOMFTFN-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO |
|---|---|
| Molecular weight | 233.69 g/mol |
| IUPAC name | 6-chloro-2,3,4,10-tetrahydro-1H-acridin-9-one |
| InChIKey | HIIMAULBOMFTFN-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)C3=C(N2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)