Products 33459-28-8
CAS 33459-28-8 is the registry number for AH 7725. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid (CAS 33459-28-8) is a chemical compound with the molecular formula C16H12O6 and a molecular weight of 300.26 g/mol. IUPAC name: 7-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid. InChIKey: NADDLRWCPPNNBA-UHFFFAOYSA-N.
| Molecular formula | C16H12O6 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | 7-(2-hydroxyethoxy)-9-oxoxanthene-2-carboxylic acid |
| InChIKey | NADDLRWCPPNNBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)C(=O)C3=C(O2)C=CC(=C3)OCCO |
Computed by PubChem (NCBI)